About ethane;1-(methoxymethyl)pyrene
ethane;1-(methoxymethyl)pyrene (PubChem CID 160555515) has the molecular formula C20H20O
and a molecular weight of 276.38 g/mol. Its IUPAC name is ethane;1-(methoxymethyl)pyrene.
Molecular Properties
| Compound Name | ethane;1-(methoxymethyl)pyrene |
| PubChem CID | 160555515 |
| Molecular Formula | C20H20O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | ethane;1-(methoxymethyl)pyrene |
| SMILES | CC.COCc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C18H14O.C2H6/c1-19-11-15-8-7-14-6-5-12-3-2-4-13-9-10-16(15)18(14)17(12)13;1-2/h2-10H,11H2,1H3;1-2H3 |
| InChIKey | QYQBDAQASOETIT-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(methoxymethyl)pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(methoxymethyl)pyrene?
The IUPAC name of ethane;1-(methoxymethyl)pyrene (CID 160555515) is ethane;1-(methoxymethyl)pyrene.
What is the SMILES notation for ethane;1-(methoxymethyl)pyrene?
The canonical SMILES for ethane;1-(methoxymethyl)pyrene is CC.COCc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of ethane;1-(methoxymethyl)pyrene?
The InChIKey is QYQBDAQASOETIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O.C2H6/c1-19-11-15-8-7-14-6-5-12-3-2-4-13-9-10-16(15)18(14)17(12)13;1-2/h2-10H,11H2,1H3;1-2H3.
What are the key properties of ethane;1-(methoxymethyl)pyrene?
ethane;1-(methoxymethyl)pyrene has a molecular weight of 276.38 g/mol, XLogP of 5.76, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(methoxymethyl)pyrene is sourced from PubChem (CID 160555515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).