About pyren-1-ylmethyl dihydrogen phosphate
pyren-1-ylmethyl dihydrogen phosphate (PubChem CID 87084266) has the molecular formula C17H13O4P
and a molecular weight of 312.26 g/mol. Its IUPAC name is pyren-1-ylmethyl dihydrogen phosphate.
Molecular Properties
| Compound Name | pyren-1-ylmethyl dihydrogen phosphate |
| PubChem CID | 87084266 |
| Molecular Formula | C17H13O4P |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | pyren-1-ylmethyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C17H13O4P/c18-22(19,20)21-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h1-9H,10H2,(H2,18,19,20) |
| InChIKey | SGOMBWXYWLLFQO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyren-1-ylmethyl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyren-1-ylmethyl dihydrogen phosphate?
The IUPAC name of pyren-1-ylmethyl dihydrogen phosphate (CID 87084266) is pyren-1-ylmethyl dihydrogen phosphate.
What is the SMILES notation for pyren-1-ylmethyl dihydrogen phosphate?
The canonical SMILES for pyren-1-ylmethyl dihydrogen phosphate is O=P(O)(O)OCc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of pyren-1-ylmethyl dihydrogen phosphate?
The InChIKey is SGOMBWXYWLLFQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13O4P/c18-22(19,20)21-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h1-9H,10H2,(H2,18,19,20).
What are the key properties of pyren-1-ylmethyl dihydrogen phosphate?
pyren-1-ylmethyl dihydrogen phosphate has a molecular weight of 312.26 g/mol, XLogP of 4.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyren-1-ylmethyl dihydrogen phosphate is sourced from PubChem (CID 87084266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).