C26H29O9P — CID 4673166
(2,3,4,5,6-pentahydroxycyclohexyl) 4-pyren-1-ylbutyl hydrogen phosphate (PubChem CID 4673166) has the molecular formula C26H29O9P and a molecular weight of 516.48 g/mol. Its IUPAC name is (2,3,4,5,6-pentahydroxycyclohexyl) 4-pyren-1-ylbutyl hydrogen phosphate.
| Compound Name | (2,3,4,5,6-pentahydroxycyclohexyl) 4-pyren-1-ylbutyl hydrogen phosphate |
|---|---|
| PubChem CID | 4673166 |
| Molecular Formula | C26H29O9P |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | (2,3,4,5,6-pentahydroxycyclohexyl) 4-pyren-1-ylbutyl hydrogen phosphate |
| SMILES | O=P(O)(OCCCCc1ccc2ccc3cccc4ccc1c2c34)OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C26H29O9P/c27-21-22(28)24(30)26(25(31)23(21)29)35-36(32,33)34-13-2-1-4-14-7-8-17-10-9-15-5-3-6-16-11-12-18(14)20(17)19(15)16/h3,5-12,21-31H,1-2,4,13H2,(H,32,33) |
| InChIKey | VBIVPQHGEARBEM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|