About methyl 2-pyren-1-ylethanimidate
methyl 2-pyren-1-ylethanimidate (PubChem CID 153490960) has the molecular formula C19H15NO
and a molecular weight of 273.34 g/mol. Its IUPAC name is methyl 2-pyren-1-ylethanimidate.
Molecular Properties
| Compound Name | methyl 2-pyren-1-ylethanimidate |
| PubChem CID | 153490960 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | methyl 2-pyren-1-ylethanimidate |
| SMILES | [H]/N=C(/Cc1ccc2ccc3cccc4ccc1c2c34)OC |
| InChI | InChI=1S/C19H15NO/c1-21-17(20)11-15-8-7-14-6-5-12-3-2-4-13-9-10-16(15)19(14)18(12)13/h2-10,20H,11H2,1H3/b20-17- |
| InChIKey | WJONVGSYLOXNCH-JZJYNLBNSA-N |
| XLogP | 4.75 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-pyren-1-ylethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-pyren-1-ylethanimidate?
The IUPAC name of methyl 2-pyren-1-ylethanimidate (CID 153490960) is methyl 2-pyren-1-ylethanimidate.
What is the SMILES notation for methyl 2-pyren-1-ylethanimidate?
The canonical SMILES for methyl 2-pyren-1-ylethanimidate is [H]/N=C(/Cc1ccc2ccc3cccc4ccc1c2c34)OC.
What is the InChIKey of methyl 2-pyren-1-ylethanimidate?
The InChIKey is WJONVGSYLOXNCH-JZJYNLBNSA-N. The full InChI is InChI=1S/C19H15NO/c1-21-17(20)11-15-8-7-14-6-5-12-3-2-4-13-9-10-16(15)19(14)18(12)13/h2-10,20H,11H2,1H3/b20-17-.
What are the key properties of methyl 2-pyren-1-ylethanimidate?
methyl 2-pyren-1-ylethanimidate has a molecular weight of 273.34 g/mol, XLogP of 4.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-pyren-1-ylethanimidate is sourced from PubChem (CID 153490960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).