C16H20NO+ — CID 167365603
2-[5-(methoxymethyl)-2-methylphenyl]-1,5-dimethylpyridin-1-ium (PubChem CID 167365603) has the molecular formula C16H20NO+ and a molecular weight of 242.34 g/mol. Its IUPAC name is 2-[5-(methoxymethyl)-2-methylphenyl]-1,5-dimethylpyridin-1-ium.
| Compound Name | 2-[5-(methoxymethyl)-2-methylphenyl]-1,5-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 167365603 |
| Molecular Formula | C16H20NO+ |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-[5-(methoxymethyl)-2-methylphenyl]-1,5-dimethylpyridin-1-ium |
| SMILES | COCc1ccc(C)c(-c2ccc(C)c[n+]2C)c1 |
| InChI | InChI=1S/C16H20NO/c1-12-5-8-16(17(3)10-12)15-9-14(11-18-4)7-6-13(15)2/h5-10H,11H2,1-4H3/q+1 |
| InChIKey | LHVLMBBZSSOSIP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|