C20H30NSi+ — CID 158022992
trimethyl-[1-methyl-6-[2-methyl-5-(2-methylpropyl)phenyl]pyridin-1-ium-3-yl]silane (PubChem CID 158022992) has the molecular formula C20H30NSi+ and a molecular weight of 312.55 g/mol. Its IUPAC name is trimethyl-[1-methyl-6-[2-methyl-5-(2-methylpropyl)phenyl]pyridin-1-ium-3-yl]silane.
| Compound Name | trimethyl-[1-methyl-6-[2-methyl-5-(2-methylpropyl)phenyl]pyridin-1-ium-3-yl]silane |
|---|---|
| PubChem CID | 158022992 |
| Molecular Formula | C20H30NSi+ |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | trimethyl-[1-methyl-6-[2-methyl-5-(2-methylpropyl)phenyl]pyridin-1-ium-3-yl]silane |
| SMILES | Cc1ccc(CC(C)C)cc1-c1ccc([Si](C)(C)C)c[n+]1C |
| InChI | InChI=1S/C20H30NSi/c1-15(2)12-17-9-8-16(3)19(13-17)20-11-10-18(14-21(20)4)22(5,6)7/h8-11,13-15H,12H2,1-7H3/q+1 |
| InChIKey | IUSNBVLYWCMBQE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|