C25H34N+ — CID 177075114
1-methyl-2-(3-methyl-5,6,7,8,8a,9,10,10a-octahydroanthracen-2-yl)-5-(2-methylpropyl)pyridin-1-ium (PubChem CID 177075114) has the molecular formula C25H34N+ and a molecular weight of 348.55 g/mol. Its IUPAC name is 1-methyl-2-(3-methyl-5,6,7,8,8a,9,10,10a-octahydroanthracen-2-yl)-5-(2-methylpropyl)pyridin-1-ium.
| Compound Name | 1-methyl-2-(3-methyl-5,6,7,8,8a,9,10,10a-octahydroanthracen-2-yl)-5-(2-methylpropyl)pyridin-1-ium |
|---|---|
| PubChem CID | 177075114 |
| Molecular Formula | C25H34N+ |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | 1-methyl-2-(3-methyl-5,6,7,8,8a,9,10,10a-octahydroanthracen-2-yl)-5-(2-methylpropyl)pyridin-1-ium |
| SMILES | Cc1cc2c(cc1-c1ccc(CC(C)C)c[n+]1C)CC1CCCCC1C2 |
| InChI | InChI=1S/C25H34N/c1-17(2)11-19-9-10-25(26(4)16-19)24-15-23-14-21-8-6-5-7-20(21)13-22(23)12-18(24)3/h9-10,12,15-17,20-21H,5-8,11,13-14H2,1-4H3/q+1 |
| InChIKey | CHQNRCYNYGLQET-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|