C19H24N+ — CID 177074930
1-methyl-2-(6-methyl-2,3-dihydro-1H-inden-5-yl)-5-propan-2-ylpyridin-1-ium (PubChem CID 177074930) has the molecular formula C19H24N+ and a molecular weight of 266.41 g/mol. Its IUPAC name is 1-methyl-2-(6-methyl-2,3-dihydro-1H-inden-5-yl)-5-propan-2-ylpyridin-1-ium.
| Compound Name | 1-methyl-2-(6-methyl-2,3-dihydro-1H-inden-5-yl)-5-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 177074930 |
| Molecular Formula | C19H24N+ |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 1-methyl-2-(6-methyl-2,3-dihydro-1H-inden-5-yl)-5-propan-2-ylpyridin-1-ium |
| SMILES | Cc1cc2c(cc1-c1ccc(C(C)C)c[n+]1C)CCC2 |
| InChI | InChI=1S/C19H24N/c1-13(2)17-8-9-19(20(4)12-17)18-11-16-7-5-6-15(16)10-14(18)3/h8-13H,5-7H2,1-4H3/q+1 |
| InChIKey | NPAKBSCJEZJNIO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|