C22H30N+ — CID 177075119
4-(2,2-dimethylpropyl)-1-methyl-2-(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)pyridin-1-ium (PubChem CID 177075119) has the molecular formula C22H30N+ and a molecular weight of 308.49 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-1-methyl-2-(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)pyridin-1-ium.
| Compound Name | 4-(2,2-dimethylpropyl)-1-methyl-2-(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 177075119 |
| Molecular Formula | C22H30N+ |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-1-methyl-2-(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)pyridin-1-ium |
| SMILES | Cc1cc2c(cc1-c1cc(CC(C)(C)C)cc[n+]1C)CCCC2 |
| InChI | InChI=1S/C22H30N/c1-16-12-18-8-6-7-9-19(18)14-20(16)21-13-17(10-11-23(21)5)15-22(2,3)4/h10-14H,6-9,15H2,1-5H3/q+1 |
| InChIKey | YVVQXRZQKGLLSP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|