C22H32N+ — CID 160661708
4-(2,2-dimethylpropyl)-1-methyl-2-[2-methyl-4-(2-methylpropyl)phenyl]pyridin-1-ium (PubChem CID 160661708) has the molecular formula C22H32N+ and a molecular weight of 310.51 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-1-methyl-2-[2-methyl-4-(2-methylpropyl)phenyl]pyridin-1-ium.
| Compound Name | 4-(2,2-dimethylpropyl)-1-methyl-2-[2-methyl-4-(2-methylpropyl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 160661708 |
| Molecular Formula | C22H32N+ |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-1-methyl-2-[2-methyl-4-(2-methylpropyl)phenyl]pyridin-1-ium |
| SMILES | Cc1cc(CC(C)C)ccc1-c1cc(CC(C)(C)C)cc[n+]1C |
| InChI | InChI=1S/C22H32N/c1-16(2)12-18-8-9-20(17(3)13-18)21-14-19(10-11-23(21)7)15-22(4,5)6/h8-11,13-14,16H,12,15H2,1-7H3/q+1 |
| InChIKey | LFVUGVZZPLRVKF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|