C24H38NSi+ — CID 159368810
[4-tert-butyl-1-methyl-6-[2-methyl-4-(2-methylpropyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane (PubChem CID 159368810) has the molecular formula C24H38NSi+ and a molecular weight of 368.66 g/mol. Its IUPAC name is [4-tert-butyl-1-methyl-6-[2-methyl-4-(2-methylpropyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane.
| Compound Name | [4-tert-butyl-1-methyl-6-[2-methyl-4-(2-methylpropyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 159368810 |
| Molecular Formula | C24H38NSi+ |
| Molecular Weight | 368.66 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | [4-tert-butyl-1-methyl-6-[2-methyl-4-(2-methylpropyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane |
| SMILES | Cc1cc(CC(C)C)ccc1-c1cc(C(C)(C)C)c([Si](C)(C)C)c[n+]1C |
| InChI | InChI=1S/C24H38NSi/c1-17(2)13-19-11-12-20(18(3)14-19)22-15-21(24(4,5)6)23(16-25(22)7)26(8,9)10/h11-12,14-17H,13H2,1-10H3/q+1 |
| InChIKey | XPCCCNKCAQDMRQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|