C23H36GeN+ — CID 159056886
trimethyl-[1-methyl-6-[2-methyl-4-(2-methylpropyl)phenyl]-4-propan-2-ylpyridin-1-ium-3-yl]germane (PubChem CID 159056886) has the molecular formula C23H36GeN+ and a molecular weight of 399.16 g/mol. Its IUPAC name is trimethyl-[1-methyl-6-[2-methyl-4-(2-methylpropyl)phenyl]-4-propan-2-ylpyridin-1-ium-3-yl]germane.
| Compound Name | trimethyl-[1-methyl-6-[2-methyl-4-(2-methylpropyl)phenyl]-4-propan-2-ylpyridin-1-ium-3-yl]germane |
|---|---|
| PubChem CID | 159056886 |
| Molecular Formula | C23H36GeN+ |
| Molecular Weight | 399.16 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | trimethyl-[1-methyl-6-[2-methyl-4-(2-methylpropyl)phenyl]-4-propan-2-ylpyridin-1-ium-3-yl]germane |
| SMILES | Cc1cc(CC(C)C)ccc1-c1cc(C(C)C)c([Ge](C)(C)C)c[n+]1C |
| InChI | InChI=1S/C23H36GeN/c1-16(2)12-19-10-11-20(18(5)13-19)23-14-21(17(3)4)22(15-25(23)9)24(6,7)8/h10-11,13-17H,12H2,1-9H3/q+1 |
| InChIKey | CHYNAWZMLSJMGC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.16 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|