C19H26N+ — CID 123587702
2-(4-ethyl-2-methylphenyl)-1,4-dimethyl-5-propan-2-ylpyridin-1-ium (PubChem CID 123587702) has the molecular formula C19H26N+ and a molecular weight of 268.42 g/mol. Its IUPAC name is 2-(4-ethyl-2-methylphenyl)-1,4-dimethyl-5-propan-2-ylpyridin-1-ium.
| Compound Name | 2-(4-ethyl-2-methylphenyl)-1,4-dimethyl-5-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 123587702 |
| Molecular Formula | C19H26N+ |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.21 |
| IUPAC Name | 2-(4-ethyl-2-methylphenyl)-1,4-dimethyl-5-propan-2-ylpyridin-1-ium |
| SMILES | CCc1ccc(-c2cc(C)c(C(C)C)c[n+]2C)c(C)c1 |
| InChI | InChI=1S/C19H26N/c1-7-16-8-9-17(14(4)10-16)19-11-15(5)18(13(2)3)12-20(19)6/h8-13H,7H2,1-6H3/q+1 |
| InChIKey | YGZPWHDFNQDGIC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|