C20H30NSi+ — CID 160741756
[2-(2,4-dimethylphenyl)-1-methyl-5-propan-2-ylpyridin-1-ium-4-yl]-trimethylsilane (PubChem CID 160741756) has the molecular formula C20H30NSi+ and a molecular weight of 312.55 g/mol. Its IUPAC name is [2-(2,4-dimethylphenyl)-1-methyl-5-propan-2-ylpyridin-1-ium-4-yl]-trimethylsilane.
| Compound Name | [2-(2,4-dimethylphenyl)-1-methyl-5-propan-2-ylpyridin-1-ium-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 160741756 |
| Molecular Formula | C20H30NSi+ |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | [2-(2,4-dimethylphenyl)-1-methyl-5-propan-2-ylpyridin-1-ium-4-yl]-trimethylsilane |
| SMILES | Cc1ccc(-c2cc([Si](C)(C)C)c(C(C)C)c[n+]2C)c(C)c1 |
| InChI | InChI=1S/C20H30NSi/c1-14(2)18-13-21(5)19(12-20(18)22(6,7)8)17-10-9-15(3)11-16(17)4/h9-14H,1-8H3/q+1 |
| InChIKey | JWMWQJLAMXPSGO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|