C20H30GeN+ — CID 157253376
[6-(2,5-dimethylphenyl)-1-methyl-4-propan-2-ylpyridin-1-ium-3-yl]-trimethylgermane (PubChem CID 157253376) has the molecular formula C20H30GeN+ and a molecular weight of 357.08 g/mol. Its IUPAC name is [6-(2,5-dimethylphenyl)-1-methyl-4-propan-2-ylpyridin-1-ium-3-yl]-trimethylgermane.
| Compound Name | [6-(2,5-dimethylphenyl)-1-methyl-4-propan-2-ylpyridin-1-ium-3-yl]-trimethylgermane |
|---|---|
| PubChem CID | 157253376 |
| Molecular Formula | C20H30GeN+ |
| Molecular Weight | 357.08 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [6-(2,5-dimethylphenyl)-1-methyl-4-propan-2-ylpyridin-1-ium-3-yl]-trimethylgermane |
| SMILES | Cc1ccc(C)c(-c2cc(C(C)C)c([Ge](C)(C)C)c[n+]2C)c1 |
| InChI | InChI=1S/C20H30GeN/c1-14(2)17-12-20(18-11-15(3)9-10-16(18)4)22(8)13-19(17)21(5,6)7/h9-14H,1-8H3/q+1 |
| InChIKey | JMIYXDZNBVQILJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.08 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|