C23H38NSi2+ — CID 168730801
[6-[4-(2-deuteriopropan-2-yl)-2-methylphenyl]-4-[dideuterio(trimethylsilyl)methyl]-1-methylpyridin-1-ium-3-yl]-trimethylsilane (PubChem CID 168730801) has the molecular formula C23H38NSi2+ and a molecular weight of 387.75 g/mol. Its IUPAC name is [6-[4-(2-deuteriopropan-2-yl)-2-methylphenyl]-4-[dideuterio(trimethylsilyl)methyl]-1-methylpyridin-1-ium-3-yl]-trimethylsilane.
| Compound Name | [6-[4-(2-deuteriopropan-2-yl)-2-methylphenyl]-4-[dideuterio(trimethylsilyl)methyl]-1-methylpyridin-1-ium-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 168730801 |
| Molecular Formula | C23H38NSi2+ |
| Molecular Weight | 387.75 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | [6-[4-(2-deuteriopropan-2-yl)-2-methylphenyl]-4-[dideuterio(trimethylsilyl)methyl]-1-methylpyridin-1-ium-3-yl]-trimethylsilane |
| SMILES | [2H]C(C)(C)c1ccc(-c2cc(C([2H])([2H])[Si](C)(C)C)c([Si](C)(C)C)c[n+]2C)c(C)c1 |
| InChI | InChI=1S/C23H38NSi2/c1-17(2)19-11-12-21(18(3)13-19)22-14-20(16-25(5,6)7)23(15-24(22)4)26(8,9)10/h11-15,17H,16H2,1-10H3/q+1/i16D2,17D |
| InChIKey | YRXXYACELDLCDM-KPNPOICOSA-N |
| XLogP | 5.58 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.75 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|