C25H38N+ — CID 167358284
4-tert-butyl-2-(4-tert-butyl-2-methylphenyl)-1-methyl-5-(2-methylpropyl)pyridin-1-ium (PubChem CID 167358284) has the molecular formula C25H38N+ and a molecular weight of 352.59 g/mol. Its IUPAC name is 4-tert-butyl-2-(4-tert-butyl-2-methylphenyl)-1-methyl-5-(2-methylpropyl)pyridin-1-ium.
| Compound Name | 4-tert-butyl-2-(4-tert-butyl-2-methylphenyl)-1-methyl-5-(2-methylpropyl)pyridin-1-ium |
|---|---|
| PubChem CID | 167358284 |
| Molecular Formula | C25H38N+ |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | 4-tert-butyl-2-(4-tert-butyl-2-methylphenyl)-1-methyl-5-(2-methylpropyl)pyridin-1-ium |
| SMILES | Cc1cc(C(C)(C)C)ccc1-c1cc(C(C)(C)C)c(CC(C)C)c[n+]1C |
| InChI | InChI=1S/C25H38N/c1-17(2)13-19-16-26(10)23(15-22(19)25(7,8)9)21-12-11-20(14-18(21)3)24(4,5)6/h11-12,14-17H,13H2,1-10H3/q+1 |
| InChIKey | KCMIFOGJRLWVGI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|