C24H38GeN+ — CID 159317018
[5-tert-butyl-2-(4-tert-butyl-2-methylphenyl)-1-methylpyridin-1-ium-4-yl]-trimethylgermane (PubChem CID 159317018) has the molecular formula C24H38GeN+ and a molecular weight of 413.19 g/mol. Its IUPAC name is [5-tert-butyl-2-(4-tert-butyl-2-methylphenyl)-1-methylpyridin-1-ium-4-yl]-trimethylgermane.
| Compound Name | [5-tert-butyl-2-(4-tert-butyl-2-methylphenyl)-1-methylpyridin-1-ium-4-yl]-trimethylgermane |
|---|---|
| PubChem CID | 159317018 |
| Molecular Formula | C24H38GeN+ |
| Molecular Weight | 413.19 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | [5-tert-butyl-2-(4-tert-butyl-2-methylphenyl)-1-methylpyridin-1-ium-4-yl]-trimethylgermane |
| SMILES | Cc1cc(C(C)(C)C)ccc1-c1cc([Ge](C)(C)C)c(C(C)(C)C)c[n+]1C |
| InChI | InChI=1S/C24H38GeN/c1-17-14-18(23(2,3)4)12-13-19(17)22-15-21(25(8,9)10)20(16-26(22)11)24(5,6)7/h12-16H,1-11H3/q+1 |
| InChIKey | VNDFYCCBSSFYFW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.19 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|