C20H30GeN+ — CID 158154791
[2-(4-tert-butyl-2-methylphenyl)-1-methylpyridin-1-ium-4-yl]-trimethylgermane (PubChem CID 158154791) has the molecular formula C20H30GeN+ and a molecular weight of 357.08 g/mol. Its IUPAC name is [2-(4-tert-butyl-2-methylphenyl)-1-methylpyridin-1-ium-4-yl]-trimethylgermane.
| Compound Name | [2-(4-tert-butyl-2-methylphenyl)-1-methylpyridin-1-ium-4-yl]-trimethylgermane |
|---|---|
| PubChem CID | 158154791 |
| Molecular Formula | C20H30GeN+ |
| Molecular Weight | 357.08 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [2-(4-tert-butyl-2-methylphenyl)-1-methylpyridin-1-ium-4-yl]-trimethylgermane |
| SMILES | Cc1cc(C(C)(C)C)ccc1-c1cc([Ge](C)(C)C)cc[n+]1C |
| InChI | InChI=1S/C20H30GeN/c1-15-13-16(20(2,3)4)9-10-18(15)19-14-17(21(5,6)7)11-12-22(19)8/h9-14H,1-8H3/q+1 |
| InChIKey | MIPJSHRBFIODHH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.08 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|