C30H36N+ — CID 140944337
1,3,5-trimethyl-2,6-bis(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)pyridin-1-ium (PubChem CID 140944337) has the molecular formula C30H36N+ and a molecular weight of 410.63 g/mol. Its IUPAC name is 1,3,5-trimethyl-2,6-bis(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)pyridin-1-ium.
| Compound Name | 1,3,5-trimethyl-2,6-bis(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 140944337 |
| Molecular Formula | C30H36N+ |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 1,3,5-trimethyl-2,6-bis(3-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)pyridin-1-ium |
| SMILES | Cc1cc2c(cc1-c1c(C)cc(C)c(-c3cc4c(cc3C)CCCC4)[n+]1C)CCCC2 |
| InChI | InChI=1S/C30H36N/c1-19-15-23-10-6-8-12-25(23)17-27(19)29-21(3)14-22(4)30(31(29)5)28-18-26-13-9-7-11-24(26)16-20(28)2/h14-18H,6-13H2,1-5H3/q+1 |
| InChIKey | HEWSYHBSCXABTH-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|