C12H14O — CID 58928828
1-(6-methyl-2,3-dihydro-1H-inden-5-yl)ethanone (PubChem CID 58928828) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 1-(6-methyl-2,3-dihydro-1H-inden-5-yl)ethanone.
| Compound Name | 1-(6-methyl-2,3-dihydro-1H-inden-5-yl)ethanone |
|---|---|
| PubChem CID | 58928828 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 1-(6-methyl-2,3-dihydro-1H-inden-5-yl)ethanone |
| SMILES | CC(=O)c1cc2c(cc1C)CCC2 |
| InChI | InChI=1S/C12H14O/c1-8-6-10-4-3-5-11(10)7-12(8)9(2)13/h6-7H,3-5H2,1-2H3 |
| InChIKey | FPIQXFRZLKZBCK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |