C11H12O4S — CID 22003063
7-acetyl-2,3-dihydro-1H-indene-5-sulfonic acid (PubChem CID 22003063) has the molecular formula C11H12O4S and a molecular weight of 240.28 g/mol. Its IUPAC name is 7-acetyl-2,3-dihydro-1H-indene-5-sulfonic acid.
| Compound Name | 7-acetyl-2,3-dihydro-1H-indene-5-sulfonic acid |
|---|---|
| PubChem CID | 22003063 |
| Molecular Formula | C11H12O4S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 7-acetyl-2,3-dihydro-1H-indene-5-sulfonic acid |
| SMILES | CC(=O)c1cc(S(=O)(=O)O)cc2c1CCC2 |
| InChI | InChI=1S/C11H12O4S/c1-7(12)11-6-9(16(13,14)15)5-8-3-2-4-10(8)11/h5-6H,2-4H2,1H3,(H,13,14,15) |
| InChIKey | OOTMKWSBVSWECC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|