C13H22O4S — CID 162138219
11-hydroxybicyclo[5.3.1]undeca-1(10),7(11),8-triene-9-sulfonic acid;methane (PubChem CID 162138219) has the molecular formula C13H22O4S and a molecular weight of 274.38 g/mol. Its IUPAC name is 11-hydroxybicyclo[5.3.1]undeca-1(10),7(11),8-triene-9-sulfonic acid;methane.
| Compound Name | 11-hydroxybicyclo[5.3.1]undeca-1(10),7(11),8-triene-9-sulfonic acid;methane |
|---|---|
| PubChem CID | 162138219 |
| Molecular Formula | C13H22O4S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 11-hydroxybicyclo[5.3.1]undeca-1(10),7(11),8-triene-9-sulfonic acid;methane |
| SMILES | C.C.O=S(=O)(O)c1cc2c(O)c(c1)CCCCC2 |
| InChI | InChI=1S/C11H14O4S.2CH4/c12-11-8-4-2-1-3-5-9(11)7-10(6-8)16(13,14)15;;/h6-7,12H,1-5H2,(H,13,14,15);2*1H4 |
| InChIKey | ZJONGQHVDRJFFB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|