C30H36O6 — CID 102526280
7,15,23-trimethoxytetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene-25,26,27-triol (PubChem CID 102526280) has the molecular formula C30H36O6 and a molecular weight of 492.61 g/mol. Its IUPAC name is 7,15,23-trimethoxytetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene-25,26,27-triol.
| Compound Name | 7,15,23-trimethoxytetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene-25,26,27-triol |
|---|---|
| PubChem CID | 102526280 |
| Molecular Formula | C30H36O6 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 7,15,23-trimethoxytetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13(26),14,16,21(25),22-nonaene-25,26,27-triol |
| SMILES | COc1cc2c(O)c(c1)CCCc1cc(OC)cc(c1O)CCCc1cc(OC)cc(c1O)CCC2 |
| InChI | InChI=1S/C30H36O6/c1-34-25-13-19-7-4-9-21-15-26(35-2)17-23(29(21)32)11-6-12-24-18-27(36-3)16-22(30(24)33)10-5-8-20(14-25)28(19)31/h13-18,31-33H,4-12H2,1-3H3 |
| InChIKey | MCZLFLSNAKPBBM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |