C17H28O3 — CID 143278523
6,8-dimethoxy-3,4-dihydro-2H-naphthalen-1-one;ethane;propane (PubChem CID 143278523) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 6,8-dimethoxy-3,4-dihydro-2H-naphthalen-1-one;ethane;propane.
| Compound Name | 6,8-dimethoxy-3,4-dihydro-2H-naphthalen-1-one;ethane;propane |
|---|---|
| PubChem CID | 143278523 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 6,8-dimethoxy-3,4-dihydro-2H-naphthalen-1-one;ethane;propane |
| SMILES | CC.CCC.COc1cc2c(c(OC)c1)C(=O)CCC2 |
| InChI | InChI=1S/C12H14O3.C3H8.C2H6/c1-14-9-6-8-4-3-5-10(13)12(8)11(7-9)15-2;1-3-2;1-2/h6-7H,3-5H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | USPFFSDTTWYYAV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |