C16H18O3 — CID 11118740
6,8-dimethoxy-2,3,9,10-tetrahydro-1H-phenanthren-4-one (PubChem CID 11118740) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 6,8-dimethoxy-2,3,9,10-tetrahydro-1H-phenanthren-4-one.
| Compound Name | 6,8-dimethoxy-2,3,9,10-tetrahydro-1H-phenanthren-4-one |
|---|---|
| PubChem CID | 11118740 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 6,8-dimethoxy-2,3,9,10-tetrahydro-1H-phenanthren-4-one |
| SMILES | COc1cc(OC)c2c(c1)C1=C(CCCC1=O)CC2 |
| InChI | InChI=1S/C16H18O3/c1-18-11-8-13-12(15(9-11)19-2)7-6-10-4-3-5-14(17)16(10)13/h8-9H,3-7H2,1-2H3 |
| InChIKey | HTRINBIDOGELEW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |