C16H20O5 — CID 626129
3-methoxy-2-(2,4,5-trimethoxyphenyl)cyclohex-2-en-1-one (PubChem CID 626129) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-methoxy-2-(2,4,5-trimethoxyphenyl)cyclohex-2-en-1-one.
| Compound Name | 3-methoxy-2-(2,4,5-trimethoxyphenyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 626129 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-methoxy-2-(2,4,5-trimethoxyphenyl)cyclohex-2-en-1-one |
| SMILES | COC1=C(c2cc(OC)c(OC)cc2OC)C(=O)CCC1 |
| InChI | InChI=1S/C16H20O5/c1-18-12-7-5-6-11(17)16(12)10-8-14(20-3)15(21-4)9-13(10)19-2/h8-9H,5-7H2,1-4H3 |
| InChIKey | MCXOGHAGNNCDEN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |