C12H14O2 — CID 11355962
5-methoxy-7-methyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 11355962) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 5-methoxy-7-methyl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 5-methoxy-7-methyl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 11355962 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 5-methoxy-7-methyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | COc1cc(C)cc2c1CCCC2=O |
| InChI | InChI=1S/C12H14O2/c1-8-6-10-9(12(7-8)14-2)4-3-5-11(10)13/h6-7H,3-5H2,1-2H3 |
| InChIKey | YTUAYXPBTHCZLU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |