About 3-methoxy-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonyl chloride
3-methoxy-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonyl chloride (PubChem CID 43118917) has the molecular formula C11H11ClO4S
and a molecular weight of 274.72 g/mol. Its IUPAC name is 3-methoxy-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonyl chloride.
Analyze 3-methoxy-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonyl chloride?
The IUPAC name of 3-methoxy-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonyl chloride (CID 43118917) is 3-methoxy-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonyl chloride.
What is the SMILES notation for 3-methoxy-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonyl chloride?
The canonical SMILES for 3-methoxy-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonyl chloride is COc1cc2c(cc1S(=O)(=O)Cl)C(=O)CCC2.
What is the InChIKey of 3-methoxy-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonyl chloride?
The InChIKey is NBOYQSOADWAITJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClO4S/c1-16-10-5-7-3-2-4-9(13)8(7)6-11(10)17(12,14)15/h5-6H,2-4H2,1H3.
What are the key properties of 3-methoxy-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonyl chloride?
3-methoxy-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonyl chloride has a molecular weight of 274.72 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonyl chloride is sourced from PubChem (CID 43118917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).