2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride

C12H15ClO3S — CID 84713994

IUPAC2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride
SMILESCOc1cc2c(cc1CCS(=O)(=O)Cl)CCC2
InChIInChI=1S/C12H15ClO3S/c1-16-12-8-10-4-2-3-9(10)7-11(12)5-6-17(13,14)15/h7-8H,2-6H2,1H3
InChIKeyDKWXXFYRWKFTEQ-UHFFFAOYSA-N
MW274.77 g/mol
LogP2.30
Rot. Bonds4

About 2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride

2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride (PubChem CID 84713994) has the molecular formula C12H15ClO3S and a molecular weight of 274.77 g/mol. Its IUPAC name is 2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride.

Molecular Properties

Compound Name2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride
PubChem CID84713994
Molecular FormulaC12H15ClO3S
Molecular Weight274.77 g/mol
Exact Mass274.04
IUPAC Name2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride
SMILESCOc1cc2c(cc1CCS(=O)(=O)Cl)CCC2
InChIInChI=1S/C12H15ClO3S/c1-16-12-8-10-4-2-3-9(10)7-11(12)5-6-17(13,14)15/h7-8H,2-6H2,1H3
InChIKeyDKWXXFYRWKFTEQ-UHFFFAOYSA-N
XLogP2.30
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.77
LogP ≤ 52.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride?
The IUPAC name of 2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride (CID 84713994) is 2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride.
What is the SMILES notation for 2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride?
The canonical SMILES for 2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride is COc1cc2c(cc1CCS(=O)(=O)Cl)CCC2.
What is the InChIKey of 2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride?
The InChIKey is DKWXXFYRWKFTEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClO3S/c1-16-12-8-10-4-2-3-9(10)7-11(12)5-6-17(13,14)15/h7-8H,2-6H2,1H3.
What are the key properties of 2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride?
2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride has a molecular weight of 274.77 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methoxy-2,3-dihydro-1H-inden-5-yl)ethanesulfonyl chloride is sourced from PubChem (CID 84713994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).