C12H15F — CID 170343572
5-ethyl-6-(fluoromethyl)-2,3-dihydro-1H-indene (PubChem CID 170343572) has the molecular formula C12H15F and a molecular weight of 178.25 g/mol. Its IUPAC name is 5-ethyl-6-(fluoromethyl)-2,3-dihydro-1H-indene.
| Compound Name | 5-ethyl-6-(fluoromethyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 170343572 |
| Molecular Formula | C12H15F |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 5-ethyl-6-(fluoromethyl)-2,3-dihydro-1H-indene |
| SMILES | CCc1cc2c(cc1CF)CCC2 |
| InChI | InChI=1S/C12H15F/c1-2-9-6-10-4-3-5-11(10)7-12(9)8-13/h6-7H,2-5,8H2,1H3 |
| InChIKey | SFPJZRCVCFMIJP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |