About 1-(3-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethanone
1-(3-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethanone (PubChem CID 165345844) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-(3-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethanone.
Analyze 1-(3-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethanone?
The IUPAC name of 1-(3-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethanone (CID 165345844) is 1-(3-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethanone.
What is the SMILES notation for 1-(3-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethanone?
The canonical SMILES for 1-(3-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethanone is CCc1cc2c(cc1C(C)=O)CCCC2.
What is the InChIKey of 1-(3-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethanone?
The InChIKey is DHKVMFYQCIDERZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O/c1-3-11-8-12-6-4-5-7-13(12)9-14(11)10(2)15/h8-9H,3-7H2,1-2H3.
What are the key properties of 1-(3-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethanone?
1-(3-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethanone has a molecular weight of 202.30 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethanone is sourced from PubChem (CID 165345844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).