About (4-acetyl-3-ethylphenyl) hypofluorite
(4-acetyl-3-ethylphenyl) hypofluorite (PubChem CID 153392017) has the molecular formula C10H11FO2
and a molecular weight of 182.19 g/mol. Its IUPAC name is (4-acetyl-3-ethylphenyl) hypofluorite.
Molecular Properties
| Compound Name | (4-acetyl-3-ethylphenyl) hypofluorite |
| PubChem CID | 153392017 |
| Molecular Formula | C10H11FO2 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | (4-acetyl-3-ethylphenyl) hypofluorite |
| SMILES | CCc1cc(OF)ccc1C(C)=O |
| InChI | InChI=1S/C10H11FO2/c1-3-8-6-9(13-11)4-5-10(8)7(2)12/h4-6H,3H2,1-2H3 |
| InChIKey | CIMJGZBGTAJCGK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-acetyl-3-ethylphenyl) hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetyl-3-ethylphenyl) hypofluorite?
The IUPAC name of (4-acetyl-3-ethylphenyl) hypofluorite (CID 153392017) is (4-acetyl-3-ethylphenyl) hypofluorite.
What is the SMILES notation for (4-acetyl-3-ethylphenyl) hypofluorite?
The canonical SMILES for (4-acetyl-3-ethylphenyl) hypofluorite is CCc1cc(OF)ccc1C(C)=O.
What is the InChIKey of (4-acetyl-3-ethylphenyl) hypofluorite?
The InChIKey is CIMJGZBGTAJCGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO2/c1-3-8-6-9(13-11)4-5-10(8)7(2)12/h4-6H,3H2,1-2H3.
What are the key properties of (4-acetyl-3-ethylphenyl) hypofluorite?
(4-acetyl-3-ethylphenyl) hypofluorite has a molecular weight of 182.19 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetyl-3-ethylphenyl) hypofluorite is sourced from PubChem (CID 153392017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).