C10H10F3NO2 — CID 141054178
2-ethyl-4-(trifluoromethoxy)benzamide (PubChem CID 141054178) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is 2-ethyl-4-(trifluoromethoxy)benzamide.
| Compound Name | 2-ethyl-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 141054178 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2-ethyl-4-(trifluoromethoxy)benzamide |
| SMILES | CCc1cc(OC(F)(F)F)ccc1C(N)=O |
| InChI | InChI=1S/C10H10F3NO2/c1-2-6-5-7(16-10(11,12)13)3-4-8(6)9(14)15/h3-5H,2H2,1H3,(H2,14,15) |
| InChIKey | XSVWFRKCLIJUHK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |