About 3-O-ethyl 2-O-methyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate
3-O-ethyl 2-O-methyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate (PubChem CID 10611493) has the molecular formula C15H18O4
and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-O-ethyl 2-O-methyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate.
Analyze 3-O-ethyl 2-O-methyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-ethyl 2-O-methyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate?
The IUPAC name of 3-O-ethyl 2-O-methyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate (CID 10611493) is 3-O-ethyl 2-O-methyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate.
What is the SMILES notation for 3-O-ethyl 2-O-methyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate?
The canonical SMILES for 3-O-ethyl 2-O-methyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate is CCOC(=O)c1cc2c(cc1C(=O)OC)CCCC2.
What is the InChIKey of 3-O-ethyl 2-O-methyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate?
The InChIKey is JKQMJVIZNXDLDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O4/c1-3-19-15(17)13-9-11-7-5-4-6-10(11)8-12(13)14(16)18-2/h8-9H,3-7H2,1-2H3.
What are the key properties of 3-O-ethyl 2-O-methyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate?
3-O-ethyl 2-O-methyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate has a molecular weight of 262.31 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-ethyl 2-O-methyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate is sourced from PubChem (CID 10611493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).