C11H11BrO2 — CID 125427256
methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate (PubChem CID 125427256) has the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. Its IUPAC name is methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate.
| Compound Name | methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate |
|---|---|
| PubChem CID | 125427256 |
| Molecular Formula | C11H11BrO2 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1Br)CCC2 |
| InChI | InChI=1S/C11H11BrO2/c1-14-11(13)9-5-7-3-2-4-8(7)6-10(9)12/h5-6H,2-4H2,1H3 |
| InChIKey | VNKKECNIGLUTQG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |