methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate

C11H11BrO2 — CID 125427256

IUPACmethyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate
SMILESCOC(=O)c1cc2c(cc1Br)CCC2
InChIInChI=1S/C11H11BrO2/c1-14-11(13)9-5-7-3-2-4-8(7)6-10(9)12/h5-6H,2-4H2,1H3
InChIKeyVNKKECNIGLUTQG-UHFFFAOYSA-N
MW255.11 g/mol
LogP2.72
Rot. Bonds1

About methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate

methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate (PubChem CID 125427256) has the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. Its IUPAC name is methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate.

Molecular Properties

Compound Namemethyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate
PubChem CID125427256
Molecular FormulaC11H11BrO2
Molecular Weight255.11 g/mol
Exact Mass253.99
IUPAC Namemethyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate
SMILESCOC(=O)c1cc2c(cc1Br)CCC2
InChIInChI=1S/C11H11BrO2/c1-14-11(13)9-5-7-3-2-4-8(7)6-10(9)12/h5-6H,2-4H2,1H3
InChIKeyVNKKECNIGLUTQG-UHFFFAOYSA-N
XLogP2.72
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.11
LogP ≤ 52.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate?
The IUPAC name of methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate (CID 125427256) is methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate.
What is the SMILES notation for methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate?
The canonical SMILES for methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate is COC(=O)c1cc2c(cc1Br)CCC2.
What is the InChIKey of methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate?
The InChIKey is VNKKECNIGLUTQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO2/c1-14-11(13)9-5-7-3-2-4-8(7)6-10(9)12/h5-6H,2-4H2,1H3.
What are the key properties of methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate?
methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate has a molecular weight of 255.11 g/mol, XLogP of 2.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-bromo-2,3-dihydro-1H-indene-5-carboxylate is sourced from PubChem (CID 125427256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).