About 6-methoxy-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride
6-methoxy-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride (PubChem CID 67783530) has the molecular formula C11H13ClO3
and a molecular weight of 228.67 g/mol. Its IUPAC name is 6-methoxy-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride.
Analyze 6-methoxy-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride?
The IUPAC name of 6-methoxy-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride (CID 67783530) is 6-methoxy-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride.
What is the SMILES notation for 6-methoxy-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride?
The canonical SMILES for 6-methoxy-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride is COc1cc2c(cc1C(=O)O)CCC2.Cl.
What is the InChIKey of 6-methoxy-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride?
The InChIKey is RXASZQHQVFPZNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3.ClH/c1-14-10-6-8-4-2-3-7(8)5-9(10)11(12)13;/h5-6H,2-4H2,1H3,(H,12,13);1H.
What are the key properties of 6-methoxy-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride?
6-methoxy-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride has a molecular weight of 228.67 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride is sourced from PubChem (CID 67783530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).