6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid

C10H9ClO2 — CID 125449044

IUPAC6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid
SMILESO=C(O)c1cc2c(cc1Cl)CCC2
InChIInChI=1S/C10H9ClO2/c11-9-5-7-3-1-2-6(7)4-8(9)10(12)13/h4-5H,1-3H2,(H,12,13)
InChIKeyZMYXJXAMSPUXEC-UHFFFAOYSA-N
MW196.63 g/mol
LogP2.53
Rot. Bonds1

About 6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid

6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid (PubChem CID 125449044) has the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. Its IUPAC name is 6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid.

Molecular Properties

Compound Name6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid
PubChem CID125449044
Molecular FormulaC10H9ClO2
Molecular Weight196.63 g/mol
Exact Mass196.03
IUPAC Name6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid
SMILESO=C(O)c1cc2c(cc1Cl)CCC2
InChIInChI=1S/C10H9ClO2/c11-9-5-7-3-1-2-6(7)4-8(9)10(12)13/h4-5H,1-3H2,(H,12,13)
InChIKeyZMYXJXAMSPUXEC-UHFFFAOYSA-N
XLogP2.53
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.63
LogP ≤ 52.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid?
The IUPAC name of 6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid (CID 125449044) is 6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid.
What is the SMILES notation for 6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid?
The canonical SMILES for 6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid is O=C(O)c1cc2c(cc1Cl)CCC2.
What is the InChIKey of 6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid?
The InChIKey is ZMYXJXAMSPUXEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClO2/c11-9-5-7-3-1-2-6(7)4-8(9)10(12)13/h4-5H,1-3H2,(H,12,13).
What are the key properties of 6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid?
6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid has a molecular weight of 196.63 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,3-dihydro-1H-indene-5-carboxylic acid is sourced from PubChem (CID 125449044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).