C11H11ClO3 — CID 171787802
6-chloro-5-methoxy-2,3-dihydro-1H-indene-4-carboxylic acid (PubChem CID 171787802) has the molecular formula C11H11ClO3 and a molecular weight of 226.66 g/mol. Its IUPAC name is 6-chloro-5-methoxy-2,3-dihydro-1H-indene-4-carboxylic acid.
| Compound Name | 6-chloro-5-methoxy-2,3-dihydro-1H-indene-4-carboxylic acid |
|---|---|
| PubChem CID | 171787802 |
| Molecular Formula | C11H11ClO3 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 6-chloro-5-methoxy-2,3-dihydro-1H-indene-4-carboxylic acid |
| SMILES | COc1c(Cl)cc2c(c1C(=O)O)CCC2 |
| InChI | InChI=1S/C11H11ClO3/c1-15-10-8(12)5-6-3-2-4-7(6)9(10)11(13)14/h5H,2-4H2,1H3,(H,13,14) |
| InChIKey | KXTNUPMKCCQVDD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |