carbonic acid;3,6-dichloro-2-methoxybenzoic acid

C9H8Cl2O6 — CID 175112629

IUPACcarbonic acid;3,6-dichloro-2-methoxybenzoic acid
SMILESCOc1c(Cl)ccc(Cl)c1C(=O)O.O=C(O)O
InChIInChI=1S/C8H6Cl2O3.CH2O3/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;2-1(3)4/h2-3H,1H3,(H,11,12);(H2,2,3,4)
InChIKeyMCJAMCPMRZNXNZ-UHFFFAOYSA-N
MW283.06 g/mol
LogP2.92
Rot. Bonds2

About carbonic acid;3,6-dichloro-2-methoxybenzoic acid

carbonic acid;3,6-dichloro-2-methoxybenzoic acid (PubChem CID 175112629) has the molecular formula C9H8Cl2O6 and a molecular weight of 283.06 g/mol. Its IUPAC name is carbonic acid;3,6-dichloro-2-methoxybenzoic acid.

Molecular Properties

Compound Namecarbonic acid;3,6-dichloro-2-methoxybenzoic acid
PubChem CID175112629
Molecular FormulaC9H8Cl2O6
Molecular Weight283.06 g/mol
Exact Mass281.97
IUPAC Namecarbonic acid;3,6-dichloro-2-methoxybenzoic acid
SMILESCOc1c(Cl)ccc(Cl)c1C(=O)O.O=C(O)O
InChIInChI=1S/C8H6Cl2O3.CH2O3/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;2-1(3)4/h2-3H,1H3,(H,11,12);(H2,2,3,4)
InChIKeyMCJAMCPMRZNXNZ-UHFFFAOYSA-N
XLogP2.92
TPSA104.06 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.06
LogP ≤ 52.92
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze carbonic acid;3,6-dichloro-2-methoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbonic acid;3,6-dichloro-2-methoxybenzoic acid?
The IUPAC name of carbonic acid;3,6-dichloro-2-methoxybenzoic acid (CID 175112629) is carbonic acid;3,6-dichloro-2-methoxybenzoic acid.
What is the SMILES notation for carbonic acid;3,6-dichloro-2-methoxybenzoic acid?
The canonical SMILES for carbonic acid;3,6-dichloro-2-methoxybenzoic acid is COc1c(Cl)ccc(Cl)c1C(=O)O.O=C(O)O.
What is the InChIKey of carbonic acid;3,6-dichloro-2-methoxybenzoic acid?
The InChIKey is MCJAMCPMRZNXNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2O3.CH2O3/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;2-1(3)4/h2-3H,1H3,(H,11,12);(H2,2,3,4).
What are the key properties of carbonic acid;3,6-dichloro-2-methoxybenzoic acid?
carbonic acid;3,6-dichloro-2-methoxybenzoic acid has a molecular weight of 283.06 g/mol, XLogP of 2.92, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;3,6-dichloro-2-methoxybenzoic acid is sourced from PubChem (CID 175112629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).