C26H45Cl2NO3 — CID 137405087
3,6-dichloro-2-methoxybenzoic acid;N,N-dihexylhexan-1-amine (PubChem CID 137405087) has the molecular formula C26H45Cl2NO3 and a molecular weight of 490.56 g/mol. Its IUPAC name is 3,6-dichloro-2-methoxybenzoic acid;N,N-dihexylhexan-1-amine.
| Compound Name | 3,6-dichloro-2-methoxybenzoic acid;N,N-dihexylhexan-1-amine |
|---|---|
| PubChem CID | 137405087 |
| Molecular Formula | C26H45Cl2NO3 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | 3,6-dichloro-2-methoxybenzoic acid;N,N-dihexylhexan-1-amine |
| SMILES | CCCCCCN(CCCCCC)CCCCCC.COc1c(Cl)ccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C18H39N.C8H6Cl2O3/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3;1-13-7-5(10)3-2-4(9)6(7)8(11)12/h4-18H2,1-3H3;2-3H,1H3,(H,11,12) |
| InChIKey | BPAZFAAHIRYAFS-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|