C16H35NO3 — CID 157318586
carbonic acid;N,N-dipentylpentan-1-amine (PubChem CID 157318586) has the molecular formula C16H35NO3 and a molecular weight of 289.46 g/mol. Its IUPAC name is carbonic acid;N,N-dipentylpentan-1-amine.
| Compound Name | carbonic acid;N,N-dipentylpentan-1-amine |
|---|---|
| PubChem CID | 157318586 |
| Molecular Formula | C16H35NO3 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | carbonic acid;N,N-dipentylpentan-1-amine |
| SMILES | CCCCCN(CCCCC)CCCCC.O=C(O)O |
| InChI | InChI=1S/C15H33N.CH2O3/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3;2-1(3)4/h4-15H2,1-3H3;(H2,2,3,4) |
| InChIKey | BDWXJHWTFHDZBC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|