C12H18Cl2N2O4 — CID 51030995
2-(2-aminoethylamino)ethanol;3,6-dichloro-2-methoxybenzoic acid (PubChem CID 51030995) has the molecular formula C12H18Cl2N2O4 and a molecular weight of 325.19 g/mol. Its IUPAC name is 2-(2-aminoethylamino)ethanol;3,6-dichloro-2-methoxybenzoic acid.
| Compound Name | 2-(2-aminoethylamino)ethanol;3,6-dichloro-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 51030995 |
| Molecular Formula | C12H18Cl2N2O4 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-(2-aminoethylamino)ethanol;3,6-dichloro-2-methoxybenzoic acid |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)O.NCCNCCO |
| InChI | InChI=1S/C8H6Cl2O3.C4H12N2O/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;5-1-2-6-3-4-7/h2-3H,1H3,(H,11,12);6-7H,1-5H2 |
| InChIKey | NTRWZIZHUNBEKV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|