C15H11Cl4NO5 — CID 23168481
3-amino-2,5-dichlorobenzoic acid;3,6-dichloro-2-methoxybenzoic acid (PubChem CID 23168481) has the molecular formula C15H11Cl4NO5 and a molecular weight of 427.07 g/mol. Its IUPAC name is 3-amino-2,5-dichlorobenzoic acid;3,6-dichloro-2-methoxybenzoic acid.
| Compound Name | 3-amino-2,5-dichlorobenzoic acid;3,6-dichloro-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 23168481 |
| Molecular Formula | C15H11Cl4NO5 |
| Molecular Weight | 427.07 g/mol |
| Exact Mass | 424.94 |
| IUPAC Name | 3-amino-2,5-dichlorobenzoic acid;3,6-dichloro-2-methoxybenzoic acid |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)O.Nc1cc(Cl)cc(C(=O)O)c1Cl |
| InChI | InChI=1S/C8H6Cl2O3.C7H5Cl2NO2/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;8-3-1-4(7(11)12)6(9)5(10)2-3/h2-3H,1H3,(H,11,12);1-2H,10H2,(H,11,12) |
| InChIKey | SFHOQUODSKBABG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.07 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|