2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate

C12H15Cl2NO4 — CID 68783214

IUPAC2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate
SMILESCOc1c(Cl)ccc(Cl)c1C(=O)OCCOCCN
InChIInChI=1S/C12H15Cl2NO4/c1-17-11-9(14)3-2-8(13)10(11)12(16)19-7-6-18-5-4-15/h2-3H,4-7,15H2,1H3
InChIKeyWDNQXSDGXPVMQT-UHFFFAOYSA-N
MW308.16 g/mol
LogP2.13
Rot. Bonds7

About 2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate

2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate (PubChem CID 68783214) has the molecular formula C12H15Cl2NO4 and a molecular weight of 308.16 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate.

Molecular Properties

Compound Name2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate
PubChem CID68783214
Molecular FormulaC12H15Cl2NO4
Molecular Weight308.16 g/mol
Exact Mass307.04
IUPAC Name2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate
SMILESCOc1c(Cl)ccc(Cl)c1C(=O)OCCOCCN
InChIInChI=1S/C12H15Cl2NO4/c1-17-11-9(14)3-2-8(13)10(11)12(16)19-7-6-18-5-4-15/h2-3H,4-7,15H2,1H3
InChIKeyWDNQXSDGXPVMQT-UHFFFAOYSA-N
XLogP2.13
TPSA70.78 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.16
LogP ≤ 52.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate?
The IUPAC name of 2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate (CID 68783214) is 2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate.
What is the SMILES notation for 2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate?
The canonical SMILES for 2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate is COc1c(Cl)ccc(Cl)c1C(=O)OCCOCCN.
What is the InChIKey of 2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate?
The InChIKey is WDNQXSDGXPVMQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2NO4/c1-17-11-9(14)3-2-8(13)10(11)12(16)19-7-6-18-5-4-15/h2-3H,4-7,15H2,1H3.
What are the key properties of 2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate?
2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate has a molecular weight of 308.16 g/mol, XLogP of 2.13, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate is sourced from PubChem (CID 68783214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).