C12H15Cl2NO4 — CID 68783214
2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate (PubChem CID 68783214) has the molecular formula C12H15Cl2NO4 and a molecular weight of 308.16 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate.
| Compound Name | 2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 68783214 |
| Molecular Formula | C12H15Cl2NO4 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2-(2-aminoethoxy)ethyl 3,6-dichloro-2-methoxybenzoate |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)OCCOCCN |
| InChI | InChI=1S/C12H15Cl2NO4/c1-17-11-9(14)3-2-8(13)10(11)12(16)19-7-6-18-5-4-15/h2-3H,4-7,15H2,1H3 |
| InChIKey | WDNQXSDGXPVMQT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|