C14H19Cl2NO4 — CID 166995748
2-[2-(dimethylamino)ethoxy]ethyl 3,6-dichloro-2-methoxybenzoate (PubChem CID 166995748) has the molecular formula C14H19Cl2NO4 and a molecular weight of 336.22 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy]ethyl 3,6-dichloro-2-methoxybenzoate.
| Compound Name | 2-[2-(dimethylamino)ethoxy]ethyl 3,6-dichloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 166995748 |
| Molecular Formula | C14H19Cl2NO4 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy]ethyl 3,6-dichloro-2-methoxybenzoate |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)OCCOCCN(C)C |
| InChI | InChI=1S/C14H19Cl2NO4/c1-17(2)6-7-20-8-9-21-14(18)12-10(15)4-5-11(16)13(12)19-3/h4-5H,6-9H2,1-3H3 |
| InChIKey | ZSZBZZUXFWTKSU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|