About 2-aminoethyl 3,6-dichloro-2-methoxybenzoate;hydrochloride
2-aminoethyl 3,6-dichloro-2-methoxybenzoate;hydrochloride (PubChem CID 169177858) has the molecular formula C10H12Cl3NO3
and a molecular weight of 300.57 g/mol. Its IUPAC name is 2-aminoethyl 3,6-dichloro-2-methoxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | 2-aminoethyl 3,6-dichloro-2-methoxybenzoate;hydrochloride |
| PubChem CID | 169177858 |
| Molecular Formula | C10H12Cl3NO3 |
| Molecular Weight | 300.57 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 2-aminoethyl 3,6-dichloro-2-methoxybenzoate;hydrochloride |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)OCCN.Cl |
| InChI | InChI=1S/C10H11Cl2NO3.ClH/c1-15-9-7(12)3-2-6(11)8(9)10(14)16-5-4-13;/h2-3H,4-5,13H2,1H3;1H |
| InChIKey | CRUOCTKVISHCSA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-aminoethyl 3,6-dichloro-2-methoxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl 3,6-dichloro-2-methoxybenzoate;hydrochloride?
The IUPAC name of 2-aminoethyl 3,6-dichloro-2-methoxybenzoate;hydrochloride (CID 169177858) is 2-aminoethyl 3,6-dichloro-2-methoxybenzoate;hydrochloride.
What is the SMILES notation for 2-aminoethyl 3,6-dichloro-2-methoxybenzoate;hydrochloride?
The canonical SMILES for 2-aminoethyl 3,6-dichloro-2-methoxybenzoate;hydrochloride is COc1c(Cl)ccc(Cl)c1C(=O)OCCN.Cl.
What is the InChIKey of 2-aminoethyl 3,6-dichloro-2-methoxybenzoate;hydrochloride?
The InChIKey is CRUOCTKVISHCSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2NO3.ClH/c1-15-9-7(12)3-2-6(11)8(9)10(14)16-5-4-13;/h2-3H,4-5,13H2,1H3;1H.
What are the key properties of 2-aminoethyl 3,6-dichloro-2-methoxybenzoate;hydrochloride?
2-aminoethyl 3,6-dichloro-2-methoxybenzoate;hydrochloride has a molecular weight of 300.57 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 3,6-dichloro-2-methoxybenzoate;hydrochloride is sourced from PubChem (CID 169177858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).