C11H14Cl2NO8P — CID 3059410
3,6-dichloro-2-methoxybenzoic acid;2-(phosphonomethylamino)acetic acid (PubChem CID 3059410) has the molecular formula C11H14Cl2NO8P and a molecular weight of 390.11 g/mol. Its IUPAC name is 3,6-dichloro-2-methoxybenzoic acid;2-(phosphonomethylamino)acetic acid.
| Compound Name | 3,6-dichloro-2-methoxybenzoic acid;2-(phosphonomethylamino)acetic acid |
|---|---|
| PubChem CID | 3059410 |
| Molecular Formula | C11H14Cl2NO8P |
| Molecular Weight | 390.11 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 3,6-dichloro-2-methoxybenzoic acid;2-(phosphonomethylamino)acetic acid |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)O.O=C(O)CNCP(=O)(O)O |
| InChI | InChI=1S/C8H6Cl2O3.C3H8NO5P/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;5-3(6)1-4-2-10(7,8)9/h2-3H,1H3,(H,11,12);4H,1-2H2,(H,5,6)(H2,7,8,9) |
| InChIKey | UBULGKKPFDYWOS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 153.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.11 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|