2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid

C16H13ClO3 — CID 61026274

IUPAC2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid
SMILESO=C(O)c1cc(-c2ccc3c(c2)CCCO3)ccc1Cl
InChIInChI=1S/C16H13ClO3/c17-14-5-3-11(9-13(14)16(18)19)10-4-6-15-12(8-10)2-1-7-20-15/h3-6,8-9H,1-2,7H2,(H,18,19)
InChIKeyLRFWDKJFCLXEOK-UHFFFAOYSA-N
MW288.73 g/mol
LogP4.03
Rot. Bonds2

About 2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid

2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid (PubChem CID 61026274) has the molecular formula C16H13ClO3 and a molecular weight of 288.73 g/mol. Its IUPAC name is 2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid.

Molecular Properties

Compound Name2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid
PubChem CID61026274
Molecular FormulaC16H13ClO3
Molecular Weight288.73 g/mol
Exact Mass288.06
IUPAC Name2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid
SMILESO=C(O)c1cc(-c2ccc3c(c2)CCCO3)ccc1Cl
InChIInChI=1S/C16H13ClO3/c17-14-5-3-11(9-13(14)16(18)19)10-4-6-15-12(8-10)2-1-7-20-15/h3-6,8-9H,1-2,7H2,(H,18,19)
InChIKeyLRFWDKJFCLXEOK-UHFFFAOYSA-N
XLogP4.03
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.73
LogP ≤ 54.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid?
The IUPAC name of 2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid (CID 61026274) is 2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid.
What is the SMILES notation for 2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid?
The canonical SMILES for 2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid is O=C(O)c1cc(-c2ccc3c(c2)CCCO3)ccc1Cl.
What is the InChIKey of 2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid?
The InChIKey is LRFWDKJFCLXEOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClO3/c17-14-5-3-11(9-13(14)16(18)19)10-4-6-15-12(8-10)2-1-7-20-15/h3-6,8-9H,1-2,7H2,(H,18,19).
What are the key properties of 2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid?
2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid has a molecular weight of 288.73 g/mol, XLogP of 4.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(3,4-dihydro-2H-chromen-6-yl)benzoic acid is sourced from PubChem (CID 61026274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).