C15H11ClO2 — CID 114076490
2-chloro-5-(2,3-dihydro-1-benzofuran-5-yl)benzaldehyde (PubChem CID 114076490) has the molecular formula C15H11ClO2 and a molecular weight of 258.70 g/mol. Its IUPAC name is 2-chloro-5-(2,3-dihydro-1-benzofuran-5-yl)benzaldehyde.
| Compound Name | 2-chloro-5-(2,3-dihydro-1-benzofuran-5-yl)benzaldehyde |
|---|---|
| PubChem CID | 114076490 |
| Molecular Formula | C15H11ClO2 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 2-chloro-5-(2,3-dihydro-1-benzofuran-5-yl)benzaldehyde |
| SMILES | O=Cc1cc(-c2ccc3c(c2)CCO3)ccc1Cl |
| InChI | InChI=1S/C15H11ClO2/c16-14-3-1-10(8-13(14)9-17)11-2-4-15-12(7-11)5-6-18-15/h1-4,7-9H,5-6H2 |
| InChIKey | YUSVZSPKDMSSEV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|